C15H29NO2 — CID 10355020
tert-butyl N-butyl-N-hex-5-en-2-ylcarbamate (PubChem CID 10355020) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is tert-butyl N-butyl-N-hex-5-en-2-ylcarbamate.
| Compound Name | tert-butyl N-butyl-N-hex-5-en-2-ylcarbamate |
|---|---|
| PubChem CID | 10355020 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | tert-butyl N-butyl-N-hex-5-en-2-ylcarbamate |
| SMILES | C=CCCC(C)N(CCCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-7-9-11-13(3)16(12-10-8-2)14(17)18-15(4,5)6/h7,13H,1,8-12H2,2-6H3 |
| InChIKey | IFTXSGZZIKIABQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|