About [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate
[2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate (PubChem CID 59417245) has the molecular formula C14H28N2O5
and a molecular weight of 304.39 g/mol. Its IUPAC name is [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate.
Molecular Properties
| Compound Name | [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate |
| PubChem CID | 59417245 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate |
| SMILES | CCC(N)CN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O5/c1-8-10(15)9-16(11(17)19-13(2,3)4)21-12(18)20-14(5,6)7/h10H,8-9,15H2,1-7H3 |
| InChIKey | IMUARKVFUKDLAU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate?
The IUPAC name of [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate (CID 59417245) is [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate.
What is the SMILES notation for [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate?
The canonical SMILES for [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate is CCC(N)CN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate?
The InChIKey is IMUARKVFUKDLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O5/c1-8-10(15)9-16(11(17)19-13(2,3)4)21-12(18)20-14(5,6)7/h10H,8-9,15H2,1-7H3.
What are the key properties of [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate?
[2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate has a molecular weight of 304.39 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-aminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] tert-butyl carbonate is sourced from PubChem (CID 59417245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).