C18H31NO7 — CID 25185099
ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-2-enoate (PubChem CID 25185099) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-2-enoate.
| Compound Name | ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-2-enoate |
|---|---|
| PubChem CID | 25185099 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-2-enoate |
| SMILES | CCOC(=O)/C=C\CCCN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO7/c1-8-23-14(20)12-10-9-11-13-19(15(21)24-17(2,3)4)26-16(22)25-18(5,6)7/h10,12H,8-9,11,13H2,1-7H3/b12-10- |
| InChIKey | LBCVIJUFLFXFDZ-BENRWUELSA-N |
| XLogP | 3.99 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|