C13H23NO4 — CID 165352188
ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate (PubChem CID 165352188) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate.
| Compound Name | ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate |
|---|---|
| PubChem CID | 165352188 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | ethyl (Z)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate |
| SMILES | CCOC(=O)/C=C\CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO4/c1-5-17-11(15)9-7-6-8-10-14-12(16)18-13(2,3)4/h7,9H,5-6,8,10H2,1-4H3,(H,14,16)/b9-7- |
| InChIKey | HFZMXVYVTGGJRA-CLFYSBASSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|