C32H57N2O12P — CID 158684486
tert-butyl N-(3-oxopropyl)carbamate;ethyl (E)-4-diethoxyphosphorylbut-2-enoate;ethyl (2E,4E)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-2,4-dienoate (PubChem CID 158684486) has the molecular formula C32H57N2O12P and a molecular weight of 692.78 g/mol. Its IUPAC name is tert-butyl N-(3-oxopropyl)carbamate;ethyl (E)-4-diethoxyphosphorylbut-2-enoate;ethyl (2E,4E)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-2,4-dienoate.
| Compound Name | tert-butyl N-(3-oxopropyl)carbamate;ethyl (E)-4-diethoxyphosphorylbut-2-enoate;ethyl (2E,4E)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 158684486 |
| Molecular Formula | C32H57N2O12P |
| Molecular Weight | 692.78 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | tert-butyl N-(3-oxopropyl)carbamate;ethyl (E)-4-diethoxyphosphorylbut-2-enoate;ethyl (2E,4E)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-2,4-dienoate |
| SMILES | CC(C)(C)OC(=O)NCCC=O.CCOC(=O)/C=C/C=C/CCNC(=O)OC(C)(C)C.CCOC(=O)/C=C/CP(=O)(OCC)OCC |
| InChI | InChI=1S/C14H23NO4.C10H19O5P.C8H15NO3/c1-5-18-12(16)10-8-6-7-9-11-15-13(17)19-14(2,3)4;1-4-13-10(11)8-7-9-16(12,14-5-2)15-6-3;1-8(2,3)12-7(11)9-5-4-6-10/h6-8,10H,5,9,11H2,1-4H3,(H,15,17);7-8H,4-6,9H2,1-3H3;6H,4-5H2,1-3H3,(H,9,11)/b7-6+,10-8+;8-7+; |
| InChIKey | IFOBJWPAAXNMKX-TYUHFGIESA-N |
| XLogP | 6.05 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.78 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|