C13H23NO3 — CID 11160831
tert-butyl N-[(4E,6Z)-7-methoxyhepta-4,6-dienyl]carbamate (PubChem CID 11160831) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl N-[(4E,6Z)-7-methoxyhepta-4,6-dienyl]carbamate.
| Compound Name | tert-butyl N-[(4E,6Z)-7-methoxyhepta-4,6-dienyl]carbamate |
|---|---|
| PubChem CID | 11160831 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl N-[(4E,6Z)-7-methoxyhepta-4,6-dienyl]carbamate |
| SMILES | CO/C=C\C=C\CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-13(2,3)17-12(15)14-10-8-6-5-7-9-11-16-4/h5,7,9,11H,6,8,10H2,1-4H3,(H,14,15)/b7-5+,11-9- |
| InChIKey | ZBBNBVYGHMHIQG-STRRHFTISA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|