C10H23N2O2+ — CID 7019265
5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylazanium (PubChem CID 7019265) has the molecular formula C10H23N2O2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylazanium.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylazanium |
|---|---|
| PubChem CID | 7019265 |
| Molecular Formula | C10H23N2O2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.18 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylazanium |
| SMILES | CC(C)(C)OC(=O)NCCCCC[NH3+] |
| InChI | InChI=1S/C10H22N2O2/c1-10(2,3)14-9(13)12-8-6-4-5-7-11/h4-8,11H2,1-3H3,(H,12,13)/p+1 |
| InChIKey | DPLOGSUBQDREOU-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|