About 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate
2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate (PubChem CID 11001810) has the molecular formula C13H27O5PSi
and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate |
| PubChem CID | 11001810 |
| Molecular Formula | C13H27O5PSi |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate |
| SMILES | CCOP(=O)(C/C=C/C(=O)OCC[Si](C)(C)C)OCC |
| InChI | InChI=1S/C13H27O5PSi/c1-6-17-19(15,18-7-2)11-8-9-13(14)16-10-12-20(3,4)5/h8-9H,6-7,10-12H2,1-5H3/b9-8+ |
| InChIKey | WFUUYPNWXOHUBG-CMDGGOBGSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate?
The IUPAC name of 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate (CID 11001810) is 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate.
What is the SMILES notation for 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate?
The canonical SMILES for 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate is CCOP(=O)(C/C=C/C(=O)OCC[Si](C)(C)C)OCC.
What is the InChIKey of 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate?
The InChIKey is WFUUYPNWXOHUBG-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H27O5PSi/c1-6-17-19(15,18-7-2)11-8-9-13(14)16-10-12-20(3,4)5/h8-9H,6-7,10-12H2,1-5H3/b9-8+.
What are the key properties of 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate?
2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate has a molecular weight of 322.41 g/mol, XLogP of 3.69, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (E)-4-diethoxyphosphorylbut-2-enoate is sourced from PubChem (CID 11001810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).