C11H17O4Si- — CID 71402827
6-oxo-6-(2-trimethylsilylethoxy)hexa-2,4-dienoate (PubChem CID 71402827) has the molecular formula C11H17O4Si- and a molecular weight of 241.34 g/mol. Its IUPAC name is 6-oxo-6-(2-trimethylsilylethoxy)hexa-2,4-dienoate.
| Compound Name | 6-oxo-6-(2-trimethylsilylethoxy)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 71402827 |
| Molecular Formula | C11H17O4Si- |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-oxo-6-(2-trimethylsilylethoxy)hexa-2,4-dienoate |
| SMILES | C[Si](C)(C)CCOC(=O)C=CC=CC(=O)[O-] |
| InChI | InChI=1S/C11H18O4Si/c1-16(2,3)9-8-15-11(14)7-5-4-6-10(12)13/h4-7H,8-9H2,1-3H3,(H,12,13)/p-1 |
| InChIKey | WQBYLZMEOZTGIG-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|