About 2-trimethylsilylethyl 2-diazoacetate
2-trimethylsilylethyl 2-diazoacetate (PubChem CID 123321469) has the molecular formula C7H14N2O2Si
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-diazoacetate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-diazoacetate |
| PubChem CID | 123321469 |
| Molecular Formula | C7H14N2O2Si |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-trimethylsilylethyl 2-diazoacetate |
| SMILES | C[Si](C)(C)CCOC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C7H14N2O2Si/c1-12(2,3)5-4-11-7(10)6-9-8/h6H,4-5H2,1-3H3 |
| InChIKey | PBDJXDWRCUWLCK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-diazoacetate?
The IUPAC name of 2-trimethylsilylethyl 2-diazoacetate (CID 123321469) is 2-trimethylsilylethyl 2-diazoacetate.
What is the SMILES notation for 2-trimethylsilylethyl 2-diazoacetate?
The canonical SMILES for 2-trimethylsilylethyl 2-diazoacetate is C[Si](C)(C)CCOC(=O)C=[N+]=[N-].
What is the InChIKey of 2-trimethylsilylethyl 2-diazoacetate?
The InChIKey is PBDJXDWRCUWLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2Si/c1-12(2,3)5-4-11-7(10)6-9-8/h6H,4-5H2,1-3H3.
What are the key properties of 2-trimethylsilylethyl 2-diazoacetate?
2-trimethylsilylethyl 2-diazoacetate has a molecular weight of 186.29 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-diazoacetate is sourced from PubChem (CID 123321469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).