C10H10N4O4 — CID 101372875
[(2E,4E)-6-(2-diazoacetyl)oxyhexa-2,4-dienyl] 2-diazoacetate (PubChem CID 101372875) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is [(2E,4E)-6-(2-diazoacetyl)oxyhexa-2,4-dienyl] 2-diazoacetate.
| Compound Name | [(2E,4E)-6-(2-diazoacetyl)oxyhexa-2,4-dienyl] 2-diazoacetate |
|---|---|
| PubChem CID | 101372875 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | [(2E,4E)-6-(2-diazoacetyl)oxyhexa-2,4-dienyl] 2-diazoacetate |
| SMILES | [N-]=[N+]=CC(=O)OC/C=C/C=C/COC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C10H10N4O4/c11-13-7-9(15)17-5-3-1-2-4-6-18-10(16)8-14-12/h1-4,7-8H,5-6H2/b3-1+,4-2+ |
| InChIKey | PDGZQVVCKBESBD-ZPUQHVIOSA-N |
| XLogP | -0.21 |
| TPSA | 125.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|