About ethanol;ethyl 2-diazoacetate
ethanol;ethyl 2-diazoacetate (PubChem CID 161468576) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is ethanol;ethyl 2-diazoacetate.
Molecular Properties
| Compound Name | ethanol;ethyl 2-diazoacetate |
| PubChem CID | 161468576 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | ethanol;ethyl 2-diazoacetate |
| SMILES | CCO.CCOC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C4H6N2O2.C2H6O/c1-2-8-4(7)3-6-5;1-2-3/h3H,2H2,1H3;3H,2H2,1H3 |
| InChIKey | WCTNUCFMTCKIMD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze ethanol;ethyl 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl 2-diazoacetate?
The IUPAC name of ethanol;ethyl 2-diazoacetate (CID 161468576) is ethanol;ethyl 2-diazoacetate.
What is the SMILES notation for ethanol;ethyl 2-diazoacetate?
The canonical SMILES for ethanol;ethyl 2-diazoacetate is CCO.CCOC(=O)C=[N+]=[N-].
What is the InChIKey of ethanol;ethyl 2-diazoacetate?
The InChIKey is WCTNUCFMTCKIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2.C2H6O/c1-2-8-4(7)3-6-5;1-2-3/h3H,2H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl 2-diazoacetate?
ethanol;ethyl 2-diazoacetate has a molecular weight of 160.17 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl 2-diazoacetate is sourced from PubChem (CID 161468576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).