About ethanol;ethyl 2-oxoacetate
ethanol;ethyl 2-oxoacetate (PubChem CID 160797373) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is ethanol;ethyl 2-oxoacetate.
Molecular Properties
| Compound Name | ethanol;ethyl 2-oxoacetate |
| PubChem CID | 160797373 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | ethanol;ethyl 2-oxoacetate |
| SMILES | CCO.CCOC(=O)C=O |
| InChI | InChI=1S/C4H6O3.C2H6O/c1-2-7-4(6)3-5;1-2-3/h3H,2H2,1H3;3H,2H2,1H3 |
| InChIKey | SCPPIIRGTRCJSP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethanol;ethyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl 2-oxoacetate?
The IUPAC name of ethanol;ethyl 2-oxoacetate (CID 160797373) is ethanol;ethyl 2-oxoacetate.
What is the SMILES notation for ethanol;ethyl 2-oxoacetate?
The canonical SMILES for ethanol;ethyl 2-oxoacetate is CCO.CCOC(=O)C=O.
What is the InChIKey of ethanol;ethyl 2-oxoacetate?
The InChIKey is SCPPIIRGTRCJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C2H6O/c1-2-7-4(6)3-5;1-2-3/h3H,2H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl 2-oxoacetate?
ethanol;ethyl 2-oxoacetate has a molecular weight of 148.16 g/mol, XLogP of -0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl 2-oxoacetate is sourced from PubChem (CID 160797373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).