About ethyl 2-oxoacetate;N-methylmethanamine
ethyl 2-oxoacetate;N-methylmethanamine (PubChem CID 162730007) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is ethyl 2-oxoacetate;N-methylmethanamine.
Molecular Properties
| Compound Name | ethyl 2-oxoacetate;N-methylmethanamine |
| PubChem CID | 162730007 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | ethyl 2-oxoacetate;N-methylmethanamine |
| SMILES | CCOC(=O)C=O.CNC |
| InChI | InChI=1S/C4H6O3.C2H7N/c1-2-7-4(6)3-5;1-3-2/h3H,2H2,1H3;3H,1-2H3 |
| InChIKey | KISFVJLGGVHZRO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxoacetate;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxoacetate;N-methylmethanamine?
The IUPAC name of ethyl 2-oxoacetate;N-methylmethanamine (CID 162730007) is ethyl 2-oxoacetate;N-methylmethanamine.
What is the SMILES notation for ethyl 2-oxoacetate;N-methylmethanamine?
The canonical SMILES for ethyl 2-oxoacetate;N-methylmethanamine is CCOC(=O)C=O.CNC.
What is the InChIKey of ethyl 2-oxoacetate;N-methylmethanamine?
The InChIKey is KISFVJLGGVHZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C2H7N/c1-2-7-4(6)3-5;1-3-2/h3H,2H2,1H3;3H,1-2H3.
What are the key properties of ethyl 2-oxoacetate;N-methylmethanamine?
ethyl 2-oxoacetate;N-methylmethanamine has a molecular weight of 147.17 g/mol, XLogP of -0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxoacetate;N-methylmethanamine is sourced from PubChem (CID 162730007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).