About ethyl 3-(methylamino)prop-2-enoate;rubidium(1+)
ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) (PubChem CID 59119332) has the molecular formula C6H10NO2Rb
and a molecular weight of 213.62 g/mol. Its IUPAC name is ethyl 3-(methylamino)prop-2-enoate;rubidium(1+).
Molecular Properties
| Compound Name | ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) |
| PubChem CID | 59119332 |
| Molecular Formula | C6H10NO2Rb |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) |
| SMILES | CCOC(=O)/C=[C-]/NC.[Rb+] |
| InChI | InChI=1S/C6H10NO2.Rb/c1-3-9-6(8)4-5-7-2;/h4,7H,3H2,1-2H3;/q-1;+1 |
| InChIKey | PYSSDMHEKMAQJJ-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(methylamino)prop-2-enoate;rubidium(1+)?
The IUPAC name of ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) (CID 59119332) is ethyl 3-(methylamino)prop-2-enoate;rubidium(1+).
What is the SMILES notation for ethyl 3-(methylamino)prop-2-enoate;rubidium(1+)?
The canonical SMILES for ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) is CCOC(=O)/C=[C-]/NC.[Rb+].
What is the InChIKey of ethyl 3-(methylamino)prop-2-enoate;rubidium(1+)?
The InChIKey is PYSSDMHEKMAQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10NO2.Rb/c1-3-9-6(8)4-5-7-2;/h4,7H,3H2,1-2H3;/q-1;+1.
What are the key properties of ethyl 3-(methylamino)prop-2-enoate;rubidium(1+)?
ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) has a molecular weight of 213.62 g/mol, XLogP of -2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(methylamino)prop-2-enoate;rubidium(1+) is sourced from PubChem (CID 59119332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).