About ethanol;ethyl acetate
ethanol;ethyl acetate (PubChem CID 173022006) has the molecular formula C22H62O11
and a molecular weight of 502.73 g/mol. Its IUPAC name is ethanol;ethyl acetate.
Molecular Properties
| Compound Name | ethanol;ethyl acetate |
| PubChem CID | 173022006 |
| Molecular Formula | C22H62O11 |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.43 |
| IUPAC Name | ethanol;ethyl acetate |
| SMILES | CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.9C2H6O/c1-3-6-4(2)5;9*1-2-3/h3H2,1-2H3;9*3H,2H2,1H3 |
| InChIKey | QHAOVTHIKNGUML-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 208.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze ethanol;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl acetate?
The IUPAC name of ethanol;ethyl acetate (CID 173022006) is ethanol;ethyl acetate.
What is the SMILES notation for ethanol;ethyl acetate?
The canonical SMILES for ethanol;ethyl acetate is CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOC(C)=O.
What is the InChIKey of ethanol;ethyl acetate?
The InChIKey is QHAOVTHIKNGUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.9C2H6O/c1-3-6-4(2)5;9*1-2-3/h3H2,1-2H3;9*3H,2H2,1H3.
What are the key properties of ethanol;ethyl acetate?
ethanol;ethyl acetate has a molecular weight of 502.73 g/mol, XLogP of 0.56, 1 rotatable bonds, 9 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl acetate is sourced from PubChem (CID 173022006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).