C16H20N4O6 — CID 158869453
but-3-yn-2-one;ethyl 3-acetyl-1H-pyrazole-5-carboxylate;ethyl 2-diazoacetate (PubChem CID 158869453) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is but-3-yn-2-one;ethyl 3-acetyl-1H-pyrazole-5-carboxylate;ethyl 2-diazoacetate.
| Compound Name | but-3-yn-2-one;ethyl 3-acetyl-1H-pyrazole-5-carboxylate;ethyl 2-diazoacetate |
|---|---|
| PubChem CID | 158869453 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | but-3-yn-2-one;ethyl 3-acetyl-1H-pyrazole-5-carboxylate;ethyl 2-diazoacetate |
| SMILES | C#CC(C)=O.CCOC(=O)C=[N+]=[N-].CCOC(=O)c1cc(C(C)=O)n[nH]1 |
| InChI | InChI=1S/C8H10N2O3.C4H6N2O2.C4H4O/c1-3-13-8(12)7-4-6(5(2)11)9-10-7;1-2-8-4(7)3-6-5;1-3-4(2)5/h4H,3H2,1-2H3,(H,9,10);3H,2H2,1H3;1H,2H3 |
| InChIKey | JBQRKEIMLLAXBE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 151.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|