C13H16N2O2 — CID 143301397
ethyl 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazole-5-carboxylate (PubChem CID 143301397) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is ethyl 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 143301397 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | ethyl 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazole-5-carboxylate |
| SMILES | C=C/C=C(\C=C/C)c1cc(C(=O)OCC)[nH]n1 |
| InChI | InChI=1S/C13H16N2O2/c1-4-7-10(8-5-2)11-9-12(15-14-11)13(16)17-6-3/h4-5,7-9H,1,6H2,2-3H3,(H,14,15)/b8-5-,10-7+ |
| InChIKey | XFXGJVGUAYQCDU-OEPUHGBTSA-N |
| XLogP | 2.73 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|