C13H16N4OS — CID 143301434
S-[[C-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-N-methylcarbonimidoyl]amino] methanethioate (PubChem CID 143301434) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is S-[[C-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-N-methylcarbonimidoyl]amino] methanethioate.
| Compound Name | S-[[C-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-N-methylcarbonimidoyl]amino] methanethioate |
|---|---|
| PubChem CID | 143301434 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | S-[[C-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-N-methylcarbonimidoyl]amino] methanethioate |
| SMILES | C=C/C=C(\C=C/C)c1cc(/C(=N/C)NSC=O)[nH]n1 |
| InChI | InChI=1S/C13H16N4OS/c1-4-6-10(7-5-2)11-8-12(16-15-11)13(14-3)17-19-9-18/h4-9H,1H2,2-3H3,(H,14,17)(H,15,16)/b7-5-,10-6+ |
| InChIKey | UAUQNUBIUUENLE-ZPRNNRRZSA-N |
| XLogP | 2.36 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|