C14H16N6O — CID 143301158
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N'-imidazol-1-yloxy-1H-pyrazole-5-carboximidamide (PubChem CID 143301158) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N'-imidazol-1-yloxy-1H-pyrazole-5-carboximidamide.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N'-imidazol-1-yloxy-1H-pyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 143301158 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N'-imidazol-1-yloxy-1H-pyrazole-5-carboximidamide |
| SMILES | C=C/C=C(\C=C/C)c1cc(/C(N)=N/On2ccnc2)[nH]n1 |
| InChI | InChI=1S/C14H16N6O/c1-3-5-11(6-4-2)12-9-13(18-17-12)14(15)19-21-20-8-7-16-10-20/h3-10H,1H2,2H3,(H2,15,19)(H,17,18)/b6-4-,11-5+ |
| InChIKey | LXXDANJFFMUEHR-NQTKGXIKSA-N |
| XLogP | 1.50 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|