C18H17ClN2 — CID 145472553
4-benzyl-3-chloro-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridazine (PubChem CID 145472553) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-benzyl-3-chloro-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridazine.
| Compound Name | 4-benzyl-3-chloro-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridazine |
|---|---|
| PubChem CID | 145472553 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-benzyl-3-chloro-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridazine |
| SMILES | C=C/C=C(\C=C/C)c1cc(Cc2ccccc2)c(Cl)nn1 |
| InChI | InChI=1S/C18H17ClN2/c1-3-8-15(9-4-2)17-13-16(18(19)21-20-17)12-14-10-6-5-7-11-14/h3-11,13H,1,12H2,2H3/b9-4-,15-8+ |
| InChIKey | STXVQJOEFYGPQP-ZYQXXHPFSA-N |
| XLogP | 4.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|