About ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline
ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline (PubChem CID 142357463) has the molecular formula C19H25N
and a molecular weight of 267.42 g/mol. Its IUPAC name is ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline.
Molecular Properties
| Compound Name | ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline |
| PubChem CID | 142357463 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline |
| SMILES | C/C=C\C(=C/C)c1cc(CC)c2ccccc2n1.CC |
| InChI | InChI=1S/C17H19N.C2H6/c1-4-9-13(5-2)17-12-14(6-3)15-10-7-8-11-16(15)18-17;1-2/h4-5,7-12H,6H2,1-3H3;1-2H3/b9-4-,13-5+; |
| InChIKey | NAAQBTJDXDFAAO-UIMFZPGYSA-N |
| XLogP | 5.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline?
The IUPAC name of ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline (CID 142357463) is ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline.
What is the SMILES notation for ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline?
The canonical SMILES for ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline is C/C=C\C(=C/C)c1cc(CC)c2ccccc2n1.CC.
What is the InChIKey of ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline?
The InChIKey is NAAQBTJDXDFAAO-UIMFZPGYSA-N. The full InChI is InChI=1S/C17H19N.C2H6/c1-4-9-13(5-2)17-12-14(6-3)15-10-7-8-11-16(15)18-17;1-2/h4-5,7-12H,6H2,1-3H3;1-2H3/b9-4-,13-5+;.
What are the key properties of ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline?
ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline has a molecular weight of 267.42 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline is sourced from PubChem (CID 142357463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).