C17H19N — CID 142357464
4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline (PubChem CID 142357464) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline.
| Compound Name | 4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline |
|---|---|
| PubChem CID | 142357464 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-ethyl-2-[(2E,4Z)-hexa-2,4-dien-3-yl]quinoline |
| SMILES | C/C=C\C(=C/C)c1cc(CC)c2ccccc2n1 |
| InChI | InChI=1S/C17H19N/c1-4-9-13(5-2)17-12-14(6-3)15-10-7-8-11-16(15)18-17/h4-5,7-12H,6H2,1-3H3/b9-4-,13-5+ |
| InChIKey | LFZHGSYKPRJCPI-SMFODQAKSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|