C24H33N — CID 142151113
heptane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylquinoline (PubChem CID 142151113) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is heptane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylquinoline.
| Compound Name | heptane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylquinoline |
|---|---|
| PubChem CID | 142151113 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | heptane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylquinoline |
| SMILES | C=C(/C=C\C=C/C)c1cc(C)c2ccccc2n1.CCCCCCC |
| InChI | InChI=1S/C17H17N.C7H16/c1-4-5-6-9-13(2)17-12-14(3)15-10-7-8-11-16(15)18-17;1-3-5-7-6-4-2/h4-12H,2H2,1,3H3;3-7H2,1-2H3/b5-4-,9-6-; |
| InChIKey | GDVYWCFWQIGYAF-HRELPHSOSA-N |
| XLogP | 7.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|