C16H15N — CID 155373774
2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]quinoline (PubChem CID 155373774) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]quinoline.
| Compound Name | 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]quinoline |
|---|---|
| PubChem CID | 155373774 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]quinoline |
| SMILES | C=C(/C=C\C=C/C)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C16H15N/c1-3-4-5-8-13(2)15-12-11-14-9-6-7-10-16(14)17-15/h3-12H,2H2,1H3/b4-3-,8-5- |
| InChIKey | JPFGUUQXWMYHTL-UBNNFMAXSA-N |
| XLogP | 4.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|