C23H19BrN2 — CID 146497769
2-(4-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-phenylpyrimidine (PubChem CID 146497769) has the molecular formula C23H19BrN2 and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-phenylpyrimidine.
| Compound Name | 2-(4-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 146497769 |
| Molecular Formula | C23H19BrN2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-phenylpyrimidine |
| SMILES | C=C(/C=C\C=C/C)c1cc(-c2ccccc2)nc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C23H19BrN2/c1-3-4-6-9-17(2)21-16-22(18-10-7-5-8-11-18)26-23(25-21)19-12-14-20(24)15-13-19/h3-16H,2H2,1H3/b4-3-,9-6- |
| InChIKey | WIFDNTOHXYVYLK-UBCGXMOYSA-N |
| XLogP | 6.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|