C52H48N2 — CID 145384272
4-[(3Z,5E,7E,9E,11E)-8-(9,9-dimethylfluoren-3-yl)trideca-1,3,5,7,9,11-hexaen-6-yl]-2-phenyl-6-(4-phenylphenyl)pyrimidine;ethane (PubChem CID 145384272) has the molecular formula C52H48N2 and a molecular weight of 700.97 g/mol. Its IUPAC name is 4-[(3Z,5E,7E,9E,11E)-8-(9,9-dimethylfluoren-3-yl)trideca-1,3,5,7,9,11-hexaen-6-yl]-2-phenyl-6-(4-phenylphenyl)pyrimidine;ethane.
| Compound Name | 4-[(3Z,5E,7E,9E,11E)-8-(9,9-dimethylfluoren-3-yl)trideca-1,3,5,7,9,11-hexaen-6-yl]-2-phenyl-6-(4-phenylphenyl)pyrimidine;ethane |
|---|---|
| PubChem CID | 145384272 |
| Molecular Formula | C52H48N2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | 4-[(3Z,5E,7E,9E,11E)-8-(9,9-dimethylfluoren-3-yl)trideca-1,3,5,7,9,11-hexaen-6-yl]-2-phenyl-6-(4-phenylphenyl)pyrimidine;ethane |
| SMILES | C=C/C=C\C=C(/C=C(\C=C\C=C\C)c1ccc2c(c1)-c1ccccc1C2(C)C)c1cc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccccc2)n1.CC |
| InChI | InChI=1S/C50H42N2.C2H6/c1-5-7-11-23-40(41-31-32-46-44(34-41)43-25-17-18-26-45(43)50(46,3)4)33-42(24-12-8-6-2)48-35-47(51-49(52-48)39-21-15-10-16-22-39)38-29-27-37(28-30-38)36-19-13-9-14-20-36;1-2/h5-35H,2H2,1,3-4H3;1-2H3/b7-5+,12-8-,23-11+,40-33+,42-24+; |
| InChIKey | YPUIBELONOTFKM-YZXBWEJRSA-N |
| XLogP | 14.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|