C42H34N4 — CID 123919872
4-but-2-en-2-yl-6-[4-[4-(6-hexa-1,3,5-trien-3-yl-2-phenylpyrimidin-4-yl)phenyl]phenyl]-2-phenylpyrimidine (PubChem CID 123919872) has the molecular formula C42H34N4 and a molecular weight of 594.76 g/mol. Its IUPAC name is 4-but-2-en-2-yl-6-[4-[4-(6-hexa-1,3,5-trien-3-yl-2-phenylpyrimidin-4-yl)phenyl]phenyl]-2-phenylpyrimidine.
| Compound Name | 4-but-2-en-2-yl-6-[4-[4-(6-hexa-1,3,5-trien-3-yl-2-phenylpyrimidin-4-yl)phenyl]phenyl]-2-phenylpyrimidine |
|---|---|
| PubChem CID | 123919872 |
| Molecular Formula | C42H34N4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 4-but-2-en-2-yl-6-[4-[4-(6-hexa-1,3,5-trien-3-yl-2-phenylpyrimidin-4-yl)phenyl]phenyl]-2-phenylpyrimidine |
| SMILES | C=CC=C(C=C)c1cc(-c2ccc(-c3ccc(-c4cc(C(C)=CC)nc(-c5ccccc5)n4)cc3)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C42H34N4/c1-5-14-30(7-3)38-28-40(46-42(44-38)36-17-12-9-13-18-36)34-25-21-32(22-26-34)31-19-23-33(24-20-31)39-27-37(29(4)6-2)43-41(45-39)35-15-10-8-11-16-35/h5-28H,1,3H2,2,4H3 |
| InChIKey | SOPUICLJGBUPBV-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|