C23H18BrN — CID 143850700
4-(3-bromophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine (PubChem CID 143850700) has the molecular formula C23H18BrN and a molecular weight of 388.31 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine.
| Compound Name | 4-(3-bromophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine |
|---|---|
| PubChem CID | 143850700 |
| Molecular Formula | C23H18BrN |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-(3-bromophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine |
| SMILES | C=C/C=C(\C=C)c1cc(-c2cccc(Br)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18BrN/c1-3-9-17(4-2)22-15-20(19-12-8-13-21(24)14-19)16-23(25-22)18-10-6-5-7-11-18/h3-16H,1-2H2/b17-9+ |
| InChIKey | VPHOVEJAUCBYEN-RQZCQDPDSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|