C54H46N2 — CID 142384878
4-[3-[3-[4-benzyl-3-[(2Z,4Z)-7-pyridin-2-ylhepta-2,4-dienyl]phenyl]phenyl]phenyl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine (PubChem CID 142384878) has the molecular formula C54H46N2 and a molecular weight of 722.98 g/mol. Its IUPAC name is 4-[3-[3-[4-benzyl-3-[(2Z,4Z)-7-pyridin-2-ylhepta-2,4-dienyl]phenyl]phenyl]phenyl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine.
| Compound Name | 4-[3-[3-[4-benzyl-3-[(2Z,4Z)-7-pyridin-2-ylhepta-2,4-dienyl]phenyl]phenyl]phenyl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine |
|---|---|
| PubChem CID | 142384878 |
| Molecular Formula | C54H46N2 |
| Molecular Weight | 722.98 g/mol |
| Exact Mass | 722.37 |
| IUPAC Name | 4-[3-[3-[4-benzyl-3-[(2Z,4Z)-7-pyridin-2-ylhepta-2,4-dienyl]phenyl]phenyl]phenyl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyridine |
| SMILES | C=C/C=C(\C=C)c1cc(-c2cccc(-c3cccc(-c4ccc(Cc5ccccc5)c(C/C=C\C=C/CCc5ccccn5)c4)c3)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C54H46N2/c1-3-20-42(4-2)53-39-51(40-54(56-53)43-23-13-9-14-24-43)48-29-19-27-46(37-48)45-26-18-28-47(36-45)50-33-32-49(35-41-21-10-8-11-22-41)44(38-50)25-12-6-5-7-15-30-52-31-16-17-34-55-52/h3-14,16-24,26-29,31-34,36-40H,1-2,15,25,30,35H2/b7-5-,12-6-,42-20+ |
| InChIKey | OAPIMFYVJHRCID-QGKNQXTASA-N |
| XLogP | 13.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.98 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|