C38H31N3 — CID 139515347
4-[4-(3,4-dihydronaphthalen-1-yl)phenyl]-2-phenyl-6-[(3E,5Z)-7-pyridin-3-ylhepta-1,3,5-trien-3-yl]pyrimidine (PubChem CID 139515347) has the molecular formula C38H31N3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 4-[4-(3,4-dihydronaphthalen-1-yl)phenyl]-2-phenyl-6-[(3E,5Z)-7-pyridin-3-ylhepta-1,3,5-trien-3-yl]pyrimidine.
| Compound Name | 4-[4-(3,4-dihydronaphthalen-1-yl)phenyl]-2-phenyl-6-[(3E,5Z)-7-pyridin-3-ylhepta-1,3,5-trien-3-yl]pyrimidine |
|---|---|
| PubChem CID | 139515347 |
| Molecular Formula | C38H31N3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 4-[4-(3,4-dihydronaphthalen-1-yl)phenyl]-2-phenyl-6-[(3E,5Z)-7-pyridin-3-ylhepta-1,3,5-trien-3-yl]pyrimidine |
| SMILES | C=C/C(=C\C=C/Cc1cccnc1)c1cc(-c2ccc(C3=CCCc4ccccc43)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C38H31N3/c1-2-29(14-7-6-12-28-13-11-25-39-27-28)36-26-37(41-38(40-36)33-16-4-3-5-17-33)32-23-21-31(22-24-32)35-20-10-18-30-15-8-9-19-34(30)35/h2-9,11,13-17,19-27H,1,10,12,18H2/b7-6-,29-14+ |
| InChIKey | LRESYGBGIOHFLM-GLZPCISFSA-N |
| XLogP | 8.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|