C40H32N4 — CID 147547028
3-[8-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5,6-dihydronaphthalen-1-yl]-N-methylbenzenecarboximidamide (PubChem CID 147547028) has the molecular formula C40H32N4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 3-[8-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5,6-dihydronaphthalen-1-yl]-N-methylbenzenecarboximidamide.
| Compound Name | 3-[8-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5,6-dihydronaphthalen-1-yl]-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 147547028 |
| Molecular Formula | C40H32N4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 3-[8-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5,6-dihydronaphthalen-1-yl]-N-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\NC)c1cccc(-c2cccc3c2C(c2ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc2)=CCC3)c1 |
| InChI | InChI=1S/C40H32N4/c1-42-39(41)33-18-8-17-32(25-33)35-20-10-16-30-15-9-19-34(38(30)35)27-21-23-29(24-22-27)37-26-36(28-11-4-2-5-12-28)43-40(44-37)31-13-6-3-7-14-31/h2-8,10-14,16-26H,9,15H2,1H3,(H2,41,42) |
| InChIKey | FQALFTHUKMQQMW-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|