C50H36N4O — CID 155470703
benzenecarboximidoyl 2-[7-[3-[2-(7,8-dihydronaphthalen-2-yl)-6-phenylpyrimidin-4-yl]phenyl]naphthalen-2-yl]benzenecarboximidate (PubChem CID 155470703) has the molecular formula C50H36N4O and a molecular weight of 708.87 g/mol. Its IUPAC name is benzenecarboximidoyl 2-[7-[3-[2-(7,8-dihydronaphthalen-2-yl)-6-phenylpyrimidin-4-yl]phenyl]naphthalen-2-yl]benzenecarboximidate.
| Compound Name | benzenecarboximidoyl 2-[7-[3-[2-(7,8-dihydronaphthalen-2-yl)-6-phenylpyrimidin-4-yl]phenyl]naphthalen-2-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 155470703 |
| Molecular Formula | C50H36N4O |
| Molecular Weight | 708.87 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | benzenecarboximidoyl 2-[7-[3-[2-(7,8-dihydronaphthalen-2-yl)-6-phenylpyrimidin-4-yl]phenyl]naphthalen-2-yl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1ccccc1-c1ccc2ccc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccc6c(c5)CCC=C6)n4)c3)cc2c1 |
| InChI | InChI=1S/C50H36N4O/c51-48(36-15-5-2-6-16-36)55-49(52)45-21-10-9-20-44(45)40-26-23-34-22-25-39(30-43(34)31-40)38-18-11-19-41(28-38)47-32-46(35-13-3-1-4-14-35)53-50(54-47)42-27-24-33-12-7-8-17-37(33)29-42/h1-7,9-16,18-32,51-52H,8,17H2/b51-48+,52-49- |
| InChIKey | AQEMDNPKCPUGLG-CHDAXOIYSA-N |
| XLogP | 12.29 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.87 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|