C29H24N2 — CID 145110724
4-[3-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]-2,6-diphenylpyrimidine (PubChem CID 145110724) has the molecular formula C29H24N2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-[3-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[3-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 145110724 |
| Molecular Formula | C29H24N2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-[3-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]-2,6-diphenylpyrimidine |
| SMILES | CC1=CC(c2cccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2)=CCC1 |
| InChI | InChI=1S/C29H24N2/c1-21-10-8-15-24(18-21)25-16-9-17-26(19-25)28-20-27(22-11-4-2-5-12-22)30-29(31-28)23-13-6-3-7-14-23/h2-7,9,11-20H,8,10H2,1H3 |
| InChIKey | BBLHKZWCFSUTDO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |