C47H34N4 — CID 139518038
2-(3,5-diphenylphenyl)-4-[3-phenyl-5-(3-prop-2-enylphenyl)phenyl]-6-pyridin-2-yl-1,3,5-triazine (PubChem CID 139518038) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[3-phenyl-5-(3-prop-2-enylphenyl)phenyl]-6-pyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[3-phenyl-5-(3-prop-2-enylphenyl)phenyl]-6-pyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 139518038 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[3-phenyl-5-(3-prop-2-enylphenyl)phenyl]-6-pyridin-2-yl-1,3,5-triazine |
| SMILES | C=CCc1cccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4ccccn4)n3)c2)c1 |
| InChI | InChI=1S/C47H34N4/c1-2-15-33-16-14-23-37(26-33)41-28-40(36-21-10-5-11-22-36)31-43(32-41)46-49-45(50-47(51-46)44-24-12-13-25-48-44)42-29-38(34-17-6-3-7-18-34)27-39(30-42)35-19-8-4-9-20-35/h2-14,16-32H,1,15H2 |
| InChIKey | HQSUDBRULLGGNT-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|