C21H19N — CID 138981640
2-but-3-enyl-4,6-diphenylpyridine (PubChem CID 138981640) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-but-3-enyl-4,6-diphenylpyridine.
| Compound Name | 2-but-3-enyl-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 138981640 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-but-3-enyl-4,6-diphenylpyridine |
| SMILES | C=CCCc1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H19N/c1-2-3-14-20-15-19(17-10-6-4-7-11-17)16-21(22-20)18-12-8-5-9-13-18/h2,4-13,15-16H,1,3,14H2 |
| InChIKey | MTEBVRNGCPAXCC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|