C33H31N — CID 130199078
2-[(2Z,4Z)-5-methylocta-2,4,7-trienyl]-6-(3-methylphenyl)-4-(4-phenylphenyl)pyridine (PubChem CID 130199078) has the molecular formula C33H31N and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[(2Z,4Z)-5-methylocta-2,4,7-trienyl]-6-(3-methylphenyl)-4-(4-phenylphenyl)pyridine.
| Compound Name | 2-[(2Z,4Z)-5-methylocta-2,4,7-trienyl]-6-(3-methylphenyl)-4-(4-phenylphenyl)pyridine |
|---|---|
| PubChem CID | 130199078 |
| Molecular Formula | C33H31N |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-[(2Z,4Z)-5-methylocta-2,4,7-trienyl]-6-(3-methylphenyl)-4-(4-phenylphenyl)pyridine |
| SMILES | C=CC/C(C)=C\C=C/Cc1cc(-c2ccc(-c3ccccc3)cc2)cc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C33H31N/c1-4-11-25(2)12-8-9-17-32-23-31(24-33(34-32)30-16-10-13-26(3)22-30)29-20-18-28(19-21-29)27-14-6-5-7-15-27/h4-10,12-16,18-24H,1,11,17H2,2-3H3/b9-8-,25-12- |
| InChIKey | OEXCWVRQBWQMLK-WSYJLOBCSA-N |
| XLogP | 9.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|