C51H48N4 — CID 146384950
2-[4-[1-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenylpyrimidin-2-yl)phenyl]cyclohexyl]phenyl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine (PubChem CID 146384950) has the molecular formula C51H48N4 and a molecular weight of 716.97 g/mol. Its IUPAC name is 2-[4-[1-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenylpyrimidin-2-yl)phenyl]cyclohexyl]phenyl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine.
| Compound Name | 2-[4-[1-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenylpyrimidin-2-yl)phenyl]cyclohexyl]phenyl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine |
|---|---|
| PubChem CID | 146384950 |
| Molecular Formula | C51H48N4 |
| Molecular Weight | 716.97 g/mol |
| Exact Mass | 716.39 |
| IUPAC Name | 2-[4-[1-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenylpyrimidin-2-yl)phenyl]cyclohexyl]phenyl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine |
| SMILES | C=C/C=C(\C=C)c1cc(C(/C=C\C)=C/C=C)nc(-c2ccc(C3(c4ccc(-c5nc(C6=CCCC=C6)cc(-c6ccccc6)n5)cc4)CCCCC3)cc2)n1 |
| InChI | InChI=1S/C51H48N4/c1-5-18-37(8-4)45-35-46(38(19-6-2)20-7-3)53-49(52-45)41-25-29-43(30-26-41)51(33-16-11-17-34-51)44-31-27-42(28-32-44)50-54-47(39-21-12-9-13-22-39)36-48(55-50)40-23-14-10-15-24-40/h5-9,12-14,18-32,35-36H,1-2,4,10-11,15-17,33-34H2,3H3/b20-7-,37-18+,38-19+ |
| InChIKey | FUKYTBJAWVEYFB-IGNDGIJHSA-N |
| XLogP | 13.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.97 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|