C60H49N3 — CID 166902740
2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[3-[3-(12',12'-dimethylspiro[cyclohexane-1,6'-indeno[1,2-b]fluorene]-2'-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 166902740) has the molecular formula C60H49N3 and a molecular weight of 812.07 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[3-[3-(12',12'-dimethylspiro[cyclohexane-1,6'-indeno[1,2-b]fluorene]-2'-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[3-[3-(12',12'-dimethylspiro[cyclohexane-1,6'-indeno[1,2-b]fluorene]-2'-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 166902740 |
| Molecular Formula | C60H49N3 |
| Molecular Weight | 812.07 g/mol |
| Exact Mass | 811.39 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[3-[3-(12',12'-dimethylspiro[cyclohexane-1,6'-indeno[1,2-b]fluorene]-2'-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccc(C7=CCCC=C7)cc6)n5)c4)c3)ccc2-c2cc3c(cc21)-c1ccccc1C31CCCCC1 |
| InChI | InChI=1S/C60H49N3/c1-59(2)53-36-46(30-31-49(53)50-38-55-51(37-54(50)59)48-24-10-11-25-52(48)60(55)32-12-5-13-33-60)44-21-14-20-43(34-44)45-22-15-23-47(35-45)58-62-56(41-18-8-4-9-19-41)61-57(63-58)42-28-26-40(27-29-42)39-16-6-3-7-17-39/h4,6,8-11,14-31,34-38H,3,5,7,12-13,32-33H2,1-2H3 |
| InChIKey | RHQHUYUMDQEYNK-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.07 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |