C51H44N6 — CID 172612937
2-cyclohepta-1,6-dien-1-yl-4-[3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)cyclohepta-1,6-dien-1-yl]phenyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine (PubChem CID 172612937) has the molecular formula C51H44N6 and a molecular weight of 740.96 g/mol. Its IUPAC name is 2-cyclohepta-1,6-dien-1-yl-4-[3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)cyclohepta-1,6-dien-1-yl]phenyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine.
| Compound Name | 2-cyclohepta-1,6-dien-1-yl-4-[3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)cyclohepta-1,6-dien-1-yl]phenyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 172612937 |
| Molecular Formula | C51H44N6 |
| Molecular Weight | 740.96 g/mol |
| Exact Mass | 740.36 |
| IUPAC Name | 2-cyclohepta-1,6-dien-1-yl-4-[3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)cyclohepta-1,6-dien-1-yl]phenyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1nc(C2=CCCCC=C2)nc(-c2cccc(-c3cccc(C4=CCCCC=C4c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)n1 |
| InChI | InChI=1S/C51H44N6/c1-3-20-36(21-4-2)46-52-47(37-22-10-5-6-11-23-37)55-50(54-46)43-31-19-29-41(35-43)40-28-18-30-42(34-40)44-32-16-9-17-33-45(44)51-56-48(38-24-12-7-13-25-38)53-49(57-51)39-26-14-8-15-27-39/h3-4,7-8,10,12-15,18-35H,1,5-6,9,11,16-17H2,2H3/b21-4-,36-20+ |
| InChIKey | WADBMEHUTPDKNE-PEBJIXDGSA-N |
| XLogP | 12.64 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.96 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|