C28H28N4 — CID 144906503
3-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-5-[(2Z,4E)-hepta-2,4-dien-4-yl]aniline (PubChem CID 144906503) has the molecular formula C28H28N4 and a molecular weight of 420.56 g/mol. Its IUPAC name is 3-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-5-[(2Z,4E)-hepta-2,4-dien-4-yl]aniline.
| Compound Name | 3-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-5-[(2Z,4E)-hepta-2,4-dien-4-yl]aniline |
|---|---|
| PubChem CID | 144906503 |
| Molecular Formula | C28H28N4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 3-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-5-[(2Z,4E)-hepta-2,4-dien-4-yl]aniline |
| SMILES | C/C=C\C(=C/CC)c1cc(N)cc(-c2nc(C3=CCCC=C3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C28H28N4/c1-3-11-20(12-4-2)23-17-24(19-25(29)18-23)28-31-26(21-13-7-5-8-14-21)30-27(32-28)22-15-9-6-10-16-22/h3,5,7-9,11-19H,4,6,10,29H2,1-2H3/b11-3-,20-12+ |
| InChIKey | CKGQMEUCQGQJIO-GJHHGQNGSA-N |
| XLogP | 6.89 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|