C21H18BrN3 — CID 163977720
2-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine (PubChem CID 163977720) has the molecular formula C21H18BrN3 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163977720 |
| Molecular Formula | C21H18BrN3 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine |
| SMILES | C=C(Br)/C=C\C(=C)c1nc(C2=CCCC=C2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H18BrN3/c1-15(13-14-16(2)22)19-23-20(17-9-5-3-6-10-17)25-21(24-19)18-11-7-4-8-12-18/h3,5-7,9-14H,1-2,4,8H2/b14-13- |
| InChIKey | SVQJCPHNNMMMRN-YPKPFQOOSA-N |
| XLogP | 5.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|