C14H20 — CID 156791104
cyclohexa-1,5-dien-1-ylbenzene;methane (PubChem CID 156791104) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylbenzene;methane.
| Compound Name | cyclohexa-1,5-dien-1-ylbenzene;methane |
|---|---|
| PubChem CID | 156791104 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylbenzene;methane |
| SMILES | C.C.C1=CC(c2ccccc2)=CCC1 |
| InChI | InChI=1S/C12H12.2CH4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h1,3-5,7-10H,2,6H2;2*1H4 |
| InChIKey | OZDQQMMXBZRKOG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |