C17H18 — CID 142034802
cyclohexa-1,5-dien-1-ylbenzene;(E)-pent-3-en-1-yne (PubChem CID 142034802) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylbenzene;(E)-pent-3-en-1-yne.
| Compound Name | cyclohexa-1,5-dien-1-ylbenzene;(E)-pent-3-en-1-yne |
|---|---|
| PubChem CID | 142034802 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylbenzene;(E)-pent-3-en-1-yne |
| SMILES | C#C/C=C/C.C1=CC(c2ccccc2)=CCC1 |
| InChI | InChI=1S/C12H12.C5H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1,3-5,7-10H,2,6H2;1,4-5H,2H3/b;5-4+ |
| InChIKey | VILMUZDXAABTGO-RCKHEGBHSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|