C32H29N — CID 175264939
cyclohexa-1,5-dien-1-ylbenzene;9-(4-ethylphenyl)carbazole (PubChem CID 175264939) has the molecular formula C32H29N and a molecular weight of 427.59 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylbenzene;9-(4-ethylphenyl)carbazole.
| Compound Name | cyclohexa-1,5-dien-1-ylbenzene;9-(4-ethylphenyl)carbazole |
|---|---|
| PubChem CID | 175264939 |
| Molecular Formula | C32H29N |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylbenzene;9-(4-ethylphenyl)carbazole |
| SMILES | C1=CC(c2ccccc2)=CCC1.CCc1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C20H17N.C12H12/c1-2-15-11-13-16(14-12-15)21-19-9-5-3-7-17(19)18-8-4-6-10-20(18)21;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-14H,2H2,1H3;1,3-5,7-10H,2,6H2 |
| InChIKey | MPMSTAJOPMPMID-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |