C21H17N3 — CID 146207336
2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-phenyl-1,3,5-triazine (PubChem CID 146207336) has the molecular formula C21H17N3 and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146207336 |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-phenyl-1,3,5-triazine |
| SMILES | C1=CC(c2ccc(-c3ncnc(-c4ccccc4)n3)cc2)=CCC1 |
| InChI | InChI=1S/C21H17N3/c1-3-7-16(8-4-1)17-11-13-19(14-12-17)21-23-15-22-20(24-21)18-9-5-2-6-10-18/h2-3,5-15H,1,4H2 |
| InChIKey | KSLDTJKPOQLZDE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |