About 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine
4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine (PubChem CID 138636514) has the molecular formula C29H23N
and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine.
Molecular Properties
| Compound Name | 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine |
| PubChem CID | 138636514 |
| Molecular Formula | C29H23N |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine |
| SMILES | C1=CC(c2ccc(-c3ccnc(-c4ccc(-c5ccccc5)cc4)c3)cc2)=CCC1 |
| InChI | InChI=1S/C29H23N/c1-3-7-22(8-4-1)24-11-13-26(14-12-24)28-19-20-30-29(21-28)27-17-15-25(16-18-27)23-9-5-2-6-10-23/h2-3,5-21H,1,4H2 |
| InChIKey | GXMNCTWQDMNIJC-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine?
The IUPAC name of 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine (CID 138636514) is 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine.
What is the SMILES notation for 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine?
The canonical SMILES for 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine is C1=CC(c2ccc(-c3ccnc(-c4ccc(-c5ccccc5)cc4)c3)cc2)=CCC1.
What is the InChIKey of 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine?
The InChIKey is GXMNCTWQDMNIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23N/c1-3-7-22(8-4-1)24-11-13-26(14-12-24)28-19-20-30-29(21-28)27-17-15-25(16-18-27)23-9-5-2-6-10-23/h2-3,5-21H,1,4H2.
What are the key properties of 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine?
4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine has a molecular weight of 385.51 g/mol, XLogP of 7.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-2-(4-phenylphenyl)pyridine is sourced from PubChem (CID 138636514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).