C24H19N3 — CID 166885806
1-cyclohexa-1,5-dien-1-yl-2-(4-phenyl-2-pyridinyl)benzimidazole (PubChem CID 166885806) has the molecular formula C24H19N3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-(4-phenyl-2-pyridinyl)benzimidazole.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-(4-phenyl-2-pyridinyl)benzimidazole |
|---|---|
| PubChem CID | 166885806 |
| Molecular Formula | C24H19N3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-(4-phenyl-2-pyridinyl)benzimidazole |
| SMILES | C1=CC(n2c(-c3cc(-c4ccccc4)ccn3)nc3ccccc32)=CCC1 |
| InChI | InChI=1S/C24H19N3/c1-3-9-18(10-4-1)19-15-16-25-22(17-19)24-26-21-13-7-8-14-23(21)27(24)20-11-5-2-6-12-20/h1,3-5,7-17H,2,6H2 |
| InChIKey | UEHJEGWRCHLBBK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |