C31H23N3O — CID 162138399
1-methyl-2-[3-[3-(4-phenyl-2-pyridinyl)phenoxy]phenyl]benzimidazole (PubChem CID 162138399) has the molecular formula C31H23N3O and a molecular weight of 453.55 g/mol. Its IUPAC name is 1-methyl-2-[3-[3-(4-phenyl-2-pyridinyl)phenoxy]phenyl]benzimidazole.
| Compound Name | 1-methyl-2-[3-[3-(4-phenyl-2-pyridinyl)phenoxy]phenyl]benzimidazole |
|---|---|
| PubChem CID | 162138399 |
| Molecular Formula | C31H23N3O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-methyl-2-[3-[3-(4-phenyl-2-pyridinyl)phenoxy]phenyl]benzimidazole |
| SMILES | Cn1c(-c2cccc(Oc3cccc(-c4cc(-c5ccccc5)ccn4)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C31H23N3O/c1-34-30-16-6-5-15-28(30)33-31(34)25-12-8-14-27(20-25)35-26-13-7-11-24(19-26)29-21-23(17-18-32-29)22-9-3-2-4-10-22/h2-21H,1H3 |
| InChIKey | WEBUNZSXYBLAFB-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |