C18H17N — CID 144573791
4-cyclohexa-1,5-dien-1-yl-2-(3-methylphenyl)pyridine (PubChem CID 144573791) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-2-(3-methylphenyl)pyridine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-2-(3-methylphenyl)pyridine |
|---|---|
| PubChem CID | 144573791 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-2-(3-methylphenyl)pyridine |
| SMILES | Cc1cccc(-c2cc(C3=CCCC=C3)ccn2)c1 |
| InChI | InChI=1S/C18H17N/c1-14-6-5-9-17(12-14)18-13-16(10-11-19-18)15-7-3-2-4-8-15/h3,5-13H,2,4H2,1H3 |
| InChIKey | UOKQGMXQTMVHDU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |